2-(1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxo-7H-purin-7-yl)ethyl nicotinate structure
|
Common Name | 2-(1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxo-7H-purin-7-yl)ethyl nicotinate | ||
|---|---|---|---|---|
| CAS Number | 13425-39-3 | Molecular Weight | 329.31100 | |
| Density | 1.45g/cm3 | Boiling Point | 580.1ºC at 760mmHg | |
| Molecular Formula | C15H15N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304.6ºC | |
| Name | 2-(1,3-dimethyl-2,6-dioxopurin-7-yl)ethyl pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 580.1ºC at 760mmHg |
| Molecular Formula | C15H15N5O4 |
| Molecular Weight | 329.31100 |
| Flash Point | 304.6ºC |
| Exact Mass | 329.11200 |
| PSA | 101.01000 |
| Vapour Pressure | 1.88E-13mmHg at 25°C |
| Index of Refraction | 1.678 |
| InChIKey | ZWIAODBBEZGVPY-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(ncn2CCOC(=O)c2cccnc2)n(C)c1=O |
| HS Code | 2933990090 |
|---|
|
~%
2-(1,2,3,6-tetr... CAS#:13425-39-3 |
| Literature: Pongratz; Zirm Monatshefte fuer Chemie, 1957 , vol. 88, p. 330,332,333 |
|
~%
2-(1,2,3,6-tetr... CAS#:13425-39-3 |
| Literature: Pongratz; Zirm Monatshefte fuer Chemie, 1957 , vol. 88, p. 330,332,333 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 236-544-2 |
| hesotin |
| Etofylline nicotinate |
| 2-(1,2,3,6-Tetrahydro-1,3-dimethyl-2,6-dioxo-7H-purin-7-yl)ethyl nicotinate |
| nicotinic acid-[2-(1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-purin-7-yl)-ethyl ester] |
| Nicotinsaeure-[2-(1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydro-purin-7-yl)-aethylester] |
| 7-(2-Nicotinoyloxy-aethyl)-theophyllin |