4,4'-(1,2-diethylethylene)diphenyl bis(dihydrogen phosphate) structure
|
Common Name | 4,4'-(1,2-diethylethylene)diphenyl bis(dihydrogen phosphate) | ||
|---|---|---|---|---|
| CAS Number | 13425-53-1 | Molecular Weight | 430.32600 | |
| Density | 1.433g/cm3 | Boiling Point | 648.7ºC at 760mmHg | |
| Molecular Formula | C18H24O8P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 346.1ºC | |
| Name | 4,4'-(1,2-diethylethylene)diphenyl bis(dihydrogen phosphate) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.433g/cm3 |
|---|---|
| Boiling Point | 648.7ºC at 760mmHg |
| Molecular Formula | C18H24O8P2 |
| Molecular Weight | 430.32600 |
| Flash Point | 346.1ºC |
| Exact Mass | 430.09500 |
| PSA | 153.14000 |
| LogP | 4.31700 |
| Vapour Pressure | 1.03E-17mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | NLORYLAYLIXTID-ZCXUNETKSA-N |
| SMILES | CCC(=C(CC)c1ccc(OP(=O)(O)O)cc1)c1ccc(OP(=O)(O)O)cc1 |
| HS Code | 2919900090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Einecs 236-545-8 |