ethyldiphacil structure
|
Common Name | ethyldiphacil | ||
|---|---|---|---|---|
| CAS Number | 13426-07-8 | Molecular Weight | 339.47100 | |
| Density | N/A | Boiling Point | 444.9ºC at 760mmHg | |
| Molecular Formula | C22H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.1ºC | |
| Name | 1-(diethylamino)butan-2-yl 2,2-diphenylacetate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 444.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.47100 |
| Flash Point | 131.1ºC |
| Exact Mass | 339.22000 |
| PSA | 29.54000 |
| LogP | 4.48210 |
| Vapour Pressure | 4.12E-08mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | MLDAYGZPPRLGLE-UHFFFAOYSA-N |
| SMILES | CCC(CN(CC)CC)OC(=O)C(c1ccccc1)c1ccccc1 |
| HS Code | 2922199090 |
|---|
|
~%
ethyldiphacil CAS#:13426-07-8 |
| Literature: Torf,S.F.; Stolyarova,T.Yu. Zhurnal Organicheskoi Khimii, 1966 , vol. 2, p. 869 - 872,866 - 868 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Eterofen |
| Ethyldiphenacetate |
| Iem-506 |
| Diphenylessigsaeure-<1-diaethylaminomethyl-propylester |
| Ethyldiphacil |
| diphenyl-acetic acid-(1-diethylaminomethyl-propyl ester) |
| 1-Ethyl-2-(diethylamino)ethyl diphenylacetate |