2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde
Modify Date: 2026-08-03 11:57:46
![2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde Structure](https://www.chemsrc.com/extcaspic/397/1342891-16-0.png)
2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde structure
|
Common Name | 2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 1342891-16-0 | Molecular Weight | 189.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11NO2 |
|---|---|
| Molecular Weight | 189.21 |
| InChIKey | GGFSAWXHXJBMLF-UHFFFAOYSA-N |
| SMILES | CC1(C)C=Cc2nc(C=O)ccc2O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde? |
| A: CAS number of 2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde is 1342891-16-0. |
| Q: What is the English name of 2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde? |
| A: The English name of 2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde is 2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde. |
| Q: What is the molecular weight of 2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde? |
| A: Molecular weight of 2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde is 189.21. |
| Q: What is the SMILES notation of 2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde? |
| A: SMILES notation of 2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde is CC1(C)C=Cc2nc(C=O)ccc2O1. |
| Q: What is the InChIKey of 2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde? |
| A: InChIKey of 2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde is GGFSAWXHXJBMLF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde? |
| A: Molecular formula of 2,2-Dimethyl-2H-pyrano[3,2-b]pyridine-6-carbaldehyde is C11H11NO2. |
| Q: What is the Chinese name of 1342891-16-0? |
| A: Chinese name of 1342891-16-0 is 1342891-16-0. |