1-Methyl-2-nitro-4-(perfluoroethyl)benzene structure
|
Common Name | 1-Methyl-2-nitro-4-(perfluoroethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 134302-31-1 | Molecular Weight | 255.14100 | |
| Density | 1.429g/cm3 | Boiling Point | 210.2ºC at 760 mmHg | |
| Molecular Formula | C9H6F5NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 80.9ºC | |
| Name | 1-methyl-2-nitro-4-(1,1,2,2,2-pentafluoroethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.429g/cm3 |
|---|---|
| Boiling Point | 210.2ºC at 760 mmHg |
| Molecular Formula | C9H6F5NO2 |
| Molecular Weight | 255.14100 |
| Flash Point | 80.9ºC |
| Exact Mass | 255.03200 |
| PSA | 45.82000 |
| LogP | 4.08050 |
| Vapour Pressure | 0.282mmHg at 25°C |
| Index of Refraction | 1.445 |
| InChIKey | PTXCYVILQCXMCZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(F)(F)C(F)(F)F)cc1[N+](=O)[O-] |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1-Methyl-2-nitro-4-(perfluoroethyl)benzene |
| Benzene,1-methyl-2-nitro-4-(1,1,2,2,2-pentafluoroethyl) |
| Benzene,1-methyl-2-nitro-4-(pentafluoroethyl)-(9CI) |