N-[anilino(dimethyl)silyl]aniline structure
|
Common Name | N-[anilino(dimethyl)silyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 13435-09-1 | Molecular Weight | 242.39200 | |
| Density | 1.077g/cm3 | Boiling Point | 302.5ºC at 760 mmHg | |
| Molecular Formula | C14H18N2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.8ºC | |
| Name | N-[anilino(dimethyl)silyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.077g/cm3 |
|---|---|
| Boiling Point | 302.5ºC at 760 mmHg |
| Molecular Formula | C14H18N2Si |
| Molecular Weight | 242.39200 |
| Flash Point | 136.8ºC |
| Exact Mass | 242.12400 |
| PSA | 24.06000 |
| LogP | 4.05840 |
| Vapour Pressure | 0.000983mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | LMBXAKYWWMNNCR-UHFFFAOYSA-N |
| SMILES | C[Si](C)(Nc1ccccc1)Nc1ccccc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Silanediamine,1,1-dimethyl-N,N'-diphenyl |
| Dimethyl-di-<phenylamino>-silan |
| Bis(anilino)dimethylsilane |
| 1,1-Dimethyl-N,N'-Diphenylsilandiamin |
| Dianilinodimethylsilane |
| Me2Si(NHPh)2 |
| EINECS 236-564-1 |
| Dianilino-dimethyl-silan |
| Bis(phenylamino)dimethylsilane |
| Si,Si-Dimethyl-N,N'-diphenyl-silandiyldiamin |