conagenin structure
|
Common Name | conagenin | ||
|---|---|---|---|---|
| CAS Number | 134381-30-9 | Molecular Weight | 249.26100 | |
| Density | 1.326g/cm3 | Boiling Point | 594.1ºC at 760mmHg | |
| Molecular Formula | C10H19NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.1ºC | |
Use of conageninConagenin is an immunomodulator. Conagenin shows antitumor effects by activation of T cells and increasing antitumor effector cells[1]. |
| Name | 2-[(3,4-dihydroxy-2-methylpentanoyl)amino]-3-hydroxy-2-methylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Conagenin is an immunomodulator. Conagenin shows antitumor effects by activation of T cells and increasing antitumor effector cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.326g/cm3 |
|---|---|
| Boiling Point | 594.1ºC at 760mmHg |
| Molecular Formula | C10H19NO6 |
| Molecular Weight | 249.26100 |
| Flash Point | 313.1ºC |
| Exact Mass | 249.12100 |
| PSA | 130.58000 |
| Vapour Pressure | 1.37E-16mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | GLESHRYLRAOJPS-DHCFDGJBSA-N |
| SMILES | CC(O)C(C)C(O)C(=O)NC(C)(CO)C(=O)O |
| L-Serine,N-(3,5-dideoxy-3-methyl-D-xylonoyl)-2-methyl |
| N-(3,5-Dideoxy-3-methyl-D-xylonoyl)-2-methyl-L-serine |
| Conagenine |
| (2S)N-((2R,3S,4R)-2,4-Dihydroxy-3-methyl-pentanoyl)-2-methylserine |
| Conagenin |