1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione structure
|
Common Name | 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 13441-28-6 | Molecular Weight | 261.11200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-bromo-5,8,8-trimethyl-3-oxabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13BrO3 |
|---|---|
| Molecular Weight | 261.11200 |
| Exact Mass | 260.00500 |
| PSA | 43.37000 |
| LogP | 2.02980 |
| InChIKey | RYWWJLPKKKYWSY-UHFFFAOYSA-N |
| SMILES | CC12CCC(Br)(C(=O)OC1=O)C2(C)C |
| HS Code | 2917209090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 1-Brom-2,2,2-trifluorethyl-difluormethyl-ether |
| Difluoromethyl-1-bromo-2,2,2-trifluoroethyl ether |
| 1-bromo-2,2,3-trimethyl-cyclopentane-1,3-dicarboxylic acid anhydride |
| 1-Bromo-1-(difluoromethoxy)-2,2,2-trifluoroethane |
| 1-Brom-2,2,3-trimethyl-cyclopentan-1,3-dicarbonsaeure-anhydrid |
| d,l-Bromcamphersaeureanhydrid |
| (3-Brom-dl-camphersaeure)-anhydrid |
| Ethane,2-bromo-2-(difluoromethoxy)-1,1,1-trifluoro |
| 1-Brom-2,2,2-trifluoraethyl-difluormethylaether |