SALMFamide 1 structure
|
Common Name | SALMFamide 1 | ||
|---|---|---|---|---|
| CAS Number | 134439-73-9 | Molecular Weight | 885.04100 | |
| Density | 1.282g/cm3 | Boiling Point | 1388.7ºC at 760 mmHg | |
| Molecular Formula | C41H60N10O10S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 793.6ºC | |
Use of SALMFamide 1SALMF amide 1 is a neuropeptide[1]. |
| Name | (2S)-2-[[(2S)-2-[(2-aminoacetyl)amino]-3-phenylpropanoyl]amino]-N-[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-[[(2S)-1-amino-1-oxo-3-phenylpropan-2-yl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-3-hydroxy |
|---|---|
| Synonym | More Synonyms |
| Description | SALMF amide 1 is a neuropeptide[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.282g/cm3 |
|---|---|
| Boiling Point | 1388.7ºC at 760 mmHg |
| Molecular Formula | C41H60N10O10S |
| Molecular Weight | 885.04100 |
| Flash Point | 793.6ºC |
| Exact Mass | 884.42100 |
| PSA | 387.84000 |
| LogP | 5.87800 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | GACIWVVFDFGCKF-VDXNIVNJSA-N |
| SMILES | CSCCC(NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CO)NC(=O)C(CC(N)=O)NC(=O)C(Cc1ccccc1)NC(=O)CN)C(=O)NC(Cc1ccccc1)C(N)=O |
| Gly-phe-asn-ser-ala-leu-met-phe-NH2 |
| Gfnsalmfamide |
| L-P |
| Glycyl-L-phenylalanyl-L-asparaginyl-L-seryl-L-alanyl-L-leucyl-L-methionyl-L-phenylaninamide |
| Neuropeptide S1 |
| Salmfamide 1 |