(S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride
Modify Date: 2026-09-05 16:09:51
(S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride structure
|
Common Name | (S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1344427-22-0 | Molecular Weight | 368.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19BrClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H19BrClNO |
|---|---|
| Molecular Weight | 368.7 |
| InChIKey | CGDHYKNMIQIWDN-NTISSMGPSA-N |
| SMILES | CC(C)C(N)c1cccc(C(=O)c2ccc(Br)cc2)c1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride? |
| A: Molecular weight of (S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride is 368.7. |
| Q: What is the English name of (S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride? |
| A: The English name of (S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride is (S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride. |
| Q: What is the InChIKey of (S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride? |
| A: InChIKey of (S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride is CGDHYKNMIQIWDN-NTISSMGPSA-N. |
| Q: What is the CAS number of (S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride? |
| A: CAS number of (S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride is 1344427-22-0. |
| Q: What is the SMILES notation of (S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride? |
| A: SMILES notation of (S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride is CC(C)C(N)c1cccc(C(=O)c2ccc(Br)cc2)c1.Cl. |
| Q: What is the molecular formula of (S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride? |
| A: Molecular formula of (S)-(3-(1-Amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride is C17H19BrClNO. |
| Q: What is the Chinese name of 1344427-22-0? |
| A: Chinese name of 1344427-22-0 is 1344427-22-0. |