(2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol
Modify Date: 2025-08-27 16:43:50
(2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol structure
|
Common Name | (2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 1344595-11-4 | Molecular Weight | 218.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8F2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H8F2N2O3 |
|---|---|
| Molecular Weight | 218.16 |
| InChIKey | HJIJQDHWJPXITB-SSDOTTSWSA-N |
| SMILES | NC(CO)c1cc(F)c([N+](=O)[O-])cc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1344595-11-4? |
| A: Chinese name of 1344595-11-4 is 1344595-11-4. |
| Q: What is the SMILES notation of (2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol? |
| A: SMILES notation of (2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol is NC(CO)c1cc(F)c([N+](=O)[O-])cc1F. |
| Q: What is the molecular formula of (2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol? |
| A: Molecular formula of (2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol is C8H8F2N2O3. |
| Q: What is the CAS number of (2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol? |
| A: CAS number of (2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol is 1344595-11-4. |
| Q: What is the molecular weight of (2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol? |
| A: Molecular weight of (2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol is 218.16. |
| Q: What is the InChIKey of (2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol? |
| A: InChIKey of (2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol is HJIJQDHWJPXITB-SSDOTTSWSA-N. |
| Q: What is the English name of (2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol? |
| A: The English name of (2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol is (2S)-2-amino-2-(2,5-difluoro-4-nitrophenyl)ethan-1-ol. |