[(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate
Modify Date: 2026-08-03 10:32:17
![[(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate Structure](https://www.chemsrc.com/extcaspic/193/134476-92-9.png)
[(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate structure
|
Common Name | [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate | ||
|---|---|---|---|---|
| CAS Number | 134476-92-9 | Molecular Weight | 510.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H26O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H26O10 |
|---|---|
| Molecular Weight | 510.5 |
| InChIKey | UGMVPWAZGUPKPL-WSOYEBOPSA-N |
| SMILES | CC(=O)OC1C=C(COC(=O)c2ccccc2)C(OC(C)=O)C(OC(=O)c2ccccc2)C1OC(C)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate? |
| A: Molecular weight of [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate is 510.5. |
| Q: What is the molecular formula of [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate? |
| A: Molecular formula of [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate is C27H26O10. |
| Q: What is the SMILES notation of [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate? |
| A: SMILES notation of [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate is CC(=O)OC1C=C(COC(=O)c2ccccc2)C(OC(C)=O)C(OC(=O)c2ccccc2)C1OC(C)=O. |
| Q: What is the CAS number of [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate? |
| A: CAS number of [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate is 134476-92-9. |
| Q: What is the English name of [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate? |
| A: The English name of [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate is [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate. |
| Q: What is the Chinese name of 134476-92-9? |
| A: Chinese name of 134476-92-9 is 134476-92-9. |
| Q: What is the InChIKey of [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate? |
| A: InChIKey of [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-benzoyloxycyclohexen-1-yl]methyl benzoate is UGMVPWAZGUPKPL-WSOYEBOPSA-N. |