6-(Difluoromethyl)indoline-2,3-dione
Modify Date: 2026-08-28 14:55:14
6-(Difluoromethyl)indoline-2,3-dione structure
|
Common Name | 6-(Difluoromethyl)indoline-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 1344904-59-1 | Molecular Weight | 197.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(Difluoromethyl)indoline-2,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H5F2NO2 |
|---|---|
| Molecular Weight | 197.14 |
| InChIKey | OKEIDBMUBZAGTK-UHFFFAOYSA-N |
| SMILES | O=C1Nc2cc(C(F)F)ccc2C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 6-(Difluoromethyl)indoline-2,3-dione? |
| A: CAS number of 6-(Difluoromethyl)indoline-2,3-dione is 1344904-59-1. |
| Q: What is the InChIKey of 6-(Difluoromethyl)indoline-2,3-dione? |
| A: InChIKey of 6-(Difluoromethyl)indoline-2,3-dione is OKEIDBMUBZAGTK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 6-(Difluoromethyl)indoline-2,3-dione? |
| A: SMILES notation of 6-(Difluoromethyl)indoline-2,3-dione is O=C1Nc2cc(C(F)F)ccc2C1=O. |
| Q: What is the molecular weight of 6-(Difluoromethyl)indoline-2,3-dione? |
| A: Molecular weight of 6-(Difluoromethyl)indoline-2,3-dione is 197.14. |
| Q: What is the molecular formula of 6-(Difluoromethyl)indoline-2,3-dione? |
| A: Molecular formula of 6-(Difluoromethyl)indoline-2,3-dione is C9H5F2NO2. |
| Q: What is the Chinese name of 1344904-59-1? |
| A: Chinese name of 1344904-59-1 is 1344904-59-1. |
| Q: What is the English name of 6-(Difluoromethyl)indoline-2,3-dione? |
| A: The English name of 6-(Difluoromethyl)indoline-2,3-dione is 6-(Difluoromethyl)indoline-2,3-dione. |