ethyl 4-(bis(2-fluoroethyl)amino)benzoate structure
|
Common Name | ethyl 4-(bis(2-fluoroethyl)amino)benzoate | ||
|---|---|---|---|---|
| CAS Number | 13452-71-6 | Molecular Weight | 257.27600 | |
| Density | 1.139g/cm3 | Boiling Point | 361.2ºC at 760 mmHg | |
| Molecular Formula | C13H17F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.2ºC | |
| Name | ethyl 4-[bis(2-fluoroethyl)amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.139g/cm3 |
|---|---|
| Boiling Point | 361.2ºC at 760 mmHg |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.27600 |
| Flash Point | 172.2ºC |
| Exact Mass | 257.12300 |
| PSA | 29.54000 |
| LogP | 2.60870 |
| Vapour Pressure | 2.11E-05mmHg at 25°C |
| Index of Refraction | 1.501 |
| InChIKey | YYQWFQQDHJWAAM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(N(CCF)CCF)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| ethyl 4-(bis(2-fluoroethyl)amino)benzoate |