2-[(1E)-2-Nitro-1-propen-1-yl]fur structure
|
Common Name | 2-[(1E)-2-Nitro-1-propen-1-yl]fur | ||
|---|---|---|---|---|
| CAS Number | 134538-48-0 | Molecular Weight | 153.13500 | |
| Density | 1.217g/cm3 | Boiling Point | 229.5ºC at 760 mmHg | |
| Molecular Formula | C7H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 92.6ºC | |
| Name | 2-[(1E)-2-Nitro-1-propen-1-yl]fur |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 229.5ºC at 760 mmHg |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.13500 |
| Flash Point | 92.6ºC |
| Exact Mass | 153.04300 |
| PSA | 58.96000 |
| LogP | 2.44030 |
| Vapour Pressure | 0.105mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | ZJQJRPWHHXBVQO-AATRIKPKSA-N |
| SMILES | CC(=Cc1ccco1)[N+](=O)[O-] |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
| o-Chlor-trans-propenylbenzol |