3-[2-oxo-3-(4-phenylphenyl)propyl]quinazolin-4-one structure
|
Common Name | 3-[2-oxo-3-(4-phenylphenyl)propyl]quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 134563-06-7 | Molecular Weight | 354.40100 | |
| Density | 1.18g/cm3 | Boiling Point | 560.6ºC at 760 mmHg | |
| Molecular Formula | C23H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.8ºC | |
| Name | 3-[2-oxo-3-(4-phenylphenyl)propyl]quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 560.6ºC at 760 mmHg |
| Molecular Formula | C23H18N2O2 |
| Molecular Weight | 354.40100 |
| Flash Point | 292.8ºC |
| Exact Mass | 354.13700 |
| PSA | 51.96000 |
| LogP | 3.87530 |
| Vapour Pressure | 1.35E-12mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | GTSTXCFWWWOLKV-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)Cn1cnc2ccccc2c1=O |
|
~57%
3-[2-oxo-3-(4-p... CAS#:134563-06-7 |
| Literature: Fisnerova, Ludmila; Brunova, Bohumila; Kocfeldova, Zuzana; Tikalova, Jana; Maturova, Eva; Grimova, Jaroslava Collection of Czechoslovak Chemical Communications, 1991 , vol. 56, # 11.1 p. 2373 - 2381 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(3-((1,1'-Biphenyl)-4-yl)-2-oxopropyl)-4(3H)-quinazolinone |
| 4(3H)-Quinazolinone,3-(3-((1,1'-biphenyl)-4-yl)-2-oxopropyl) |