3-[3-[4-(2,4-difluorophenyl)phenyl]-3-oxopropyl]quinazolin-4-one structure
|
Common Name | 3-[3-[4-(2,4-difluorophenyl)phenyl]-3-oxopropyl]quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 134563-15-8 | Molecular Weight | 390.38200 | |
| Density | 1.28g/cm3 | Boiling Point | 564.4ºC at 760 mmHg | |
| Molecular Formula | C23H16F2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.1ºC | |
| Name | 3-[3-[4-(2,4-difluorophenyl)phenyl]-3-oxopropyl]quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 564.4ºC at 760 mmHg |
| Molecular Formula | C23H16F2N2O2 |
| Molecular Weight | 390.38200 |
| Flash Point | 295.1ºC |
| Exact Mass | 390.11800 |
| PSA | 51.96000 |
| LogP | 4.61470 |
| Vapour Pressure | 9.24E-13mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | QIMALGXJTQRIIE-UHFFFAOYSA-N |
| SMILES | O=C(CCn1cnc2ccccc2c1=O)c1ccc(-c2ccc(F)cc2F)cc1 |
|
~51%
3-[3-[4-(2,4-di... CAS#:134563-15-8 |
| Literature: Fisnerova, Ludmila; Brunova, Bohumila; Kocfeldova, Zuzana; Tikalova, Jana; Maturova, Eva; Grimova, Jaroslava Collection of Czechoslovak Chemical Communications, 1991 , vol. 56, # 11.1 p. 2373 - 2381 |
|
~%
3-[3-[4-(2,4-di... CAS#:134563-15-8 |
| Literature: Fisnerova, Ludmila; Brunova, Bohumila; Kocfeldova, Zuzana; Tikalova, Jana; Maturova, Eva; Grimova, Jaroslava Collection of Czechoslovak Chemical Communications, 1991 , vol. 56, # 11.1 p. 2373 - 2381 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4(3H)-Quinazolinone,3-(3-(2',4'-difluoro(1,1'-biphenyl)-4-yl)-3-oxopropyl) |
| 3-(3-(2',4'-Difluoro(1,1'-biphenyl)-4-yl)-3-oxopropyl)-4(3H)-quinazolinone |