4-[(2-chloro-4-nitrophenyl)azo]-3-methyl-1-phenyl-2-pyrazolin-5-one structure
|
Common Name | 4-[(2-chloro-4-nitrophenyl)azo]-3-methyl-1-phenyl-2-pyrazolin-5-one | ||
|---|---|---|---|---|
| CAS Number | 13458-81-6 | Molecular Weight | 357.75100 | |
| Density | 1.48g/cm3 | Boiling Point | 565.6ºC at 760 mmHg | |
| Molecular Formula | C16H12ClN5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.9ºC | |
| Name | 4-[(2-chloro-4-nitrophenyl)azo]-3-methyl-1-phenyl-2-pyrazolin-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 565.6ºC at 760 mmHg |
| Molecular Formula | C16H12ClN5O3 |
| Molecular Weight | 357.75100 |
| Flash Point | 295.9ºC |
| Exact Mass | 357.06300 |
| PSA | 103.21000 |
| LogP | 4.14700 |
| Vapour Pressure | 8.19E-13mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | DQQZSKXVLOLAOF-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1N=Nc1ccc([N+](=O)[O-])cc1Cl |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-<(2-Chloraethyl)-(2-fluoraethyl)-amino>-hydrozimtsaeure |
| 5-methyl-2-phenyl-2H-pyrazole-3,4-dione 4-[(2-chloro-4-nitro-phenyl)-hydrazone] |
| p-((2-Chloroethyl)(2-fluoroethyl)amino)hydrocinnamic acid |
| HYDROCINNAMIC ACID,p-((2-CHLOROETHYL)(2-FLUOROETHYL)AMINO) |
| 4-<(2-Chlor-aethyl)-(2-fluor-aethyl)-amino>-zimtsaeure |