1-(5-methyl-2-phenyl-2,3-dihydrofuran-4-yl)ethanone structure
|
Common Name | 1-(5-methyl-2-phenyl-2,3-dihydrofuran-4-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 13463-61-1 | Molecular Weight | 202.24900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(5-methyl-2-phenyl-2,3-dihydrofuran-4-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H14O2 |
|---|---|
| Molecular Weight | 202.24900 |
| Exact Mass | 202.09900 |
| PSA | 26.30000 |
| LogP | 3.01100 |
| InChIKey | XKDPVQLWXIOLGX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C)OC(c2ccccc2)C1 |
|
~88%
1-(5-methyl-2-p... CAS#:13463-61-1 |
| Literature: Baciocchi, Enrico; Ruzziconi, Renzo Journal of Organic Chemistry, 1991 , vol. 56, # 15 p. 4772 - 4778 |
|
~26%
1-(5-methyl-2-p... CAS#:13463-61-1 |
| Literature: Yoshida, Jun-ichi; Yano, Shinji; Ozawa, Tadahiro; Kawobata, Nariyoshi Journal of Organic Chemistry, 1985 , vol. 50, # 19 p. 3467 - 3473 |
|
~%
1-(5-methyl-2-p... CAS#:13463-61-1 |
| Literature: Yoshida, Jun-ichi; Yano, Shinji; Ozawa, Tadahiro; Kawobata, Nariyoshi Journal of Organic Chemistry, 1985 , vol. 50, # 19 p. 3467 - 3473 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-acetyl-2-methyl-5-phenyl-4,5-dihydrofuran |
| 2-phenyl-4-acetyl-5-methyl-2,3-dihydrofuran |
| 1-(2-methyl-5-phenyl-4,5-dihydro-furan-3-yl)-ethanone |
| 2-methyl-3-acetyl-5-phenyl-4,5-dihydrofuran |
| 1-(2-methyl-5-phenyl-4,5-dihydro-3-furanyl)ethanone |
| 4-acetyl-5-methyl-2-phenyl-2,3-dihydrofuran |
| Ethanone,1-(4,5-dihydro-2-methyl-5-phenyl-3-furanyl) |