Azilsartan D5 structure
|
Common Name | Azilsartan D5 | ||
|---|---|---|---|---|
| CAS Number | 1346599-45-8 | Molecular Weight | 461.48100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H15D5N4O5 | Melting Point | 174-178°C | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azilsartan D5Azilsartan D5 is the deuterium labeled Azilsartan(TAK-536), which is a specific and potent angiotensin II type 1 receptor antagonist. |
| Name | 3-[[4-[2-(5-oxo-2H-1,2,4-oxadiazol-3-yl)phenyl]phenyl]methyl]-2-(1,1,2,2,2-pentadeuterioethoxy)benzimidazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Azilsartan D5 is the deuterium labeled Azilsartan(TAK-536), which is a specific and potent angiotensin II type 1 receptor antagonist. |
|---|---|
| Related Catalog |
| Melting Point | 174-178°C |
|---|---|
| Molecular Formula | C25H15D5N4O5 |
| Molecular Weight | 461.48100 |
| Exact Mass | 461.17500 |
| PSA | 123.24000 |
| LogP | 4.19180 |
| InChIKey | KGSXMPPBFPAXLY-ZBJDZAJPSA-N |
| SMILES | CCOc1nc2cccc(C(=O)O)c2n1Cc1ccc(-c2ccccc2-c2noc(=O)[nH]2)cc1 |
| Storage condition | 2-8°C |
| 1-[[2'-(2,5-Dihydro-5-oxo-1,2,4-oxadiazol-3-yl)[1,1'-biphenyl]-4-yl]methyl]-2-(ethoxy-d5)-1H-benzimidazole-7-carboxylic Acid |
| TAK 536-d5 |
| Azilsartan-d5 |
| 2-(Ethoxy-d5)-1-[[2'-(4,5-dihydro-5-oxo-1,2,4-oxadiazol-3-yl)biphenyl-4-yl]methyl]benzimidazole-7-carboxylic Acid |
| Azilsartan D5 |