Valaciclovir iMpurity D structure
|
Common Name | Valaciclovir iMpurity D | ||
|---|---|---|---|---|
| CAS Number | 1346747-69-0 | Molecular Weight | 352.38900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H24N6O4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of Valaciclovir iMpurity DValacyclovir Related Compound D is a bioactive chemical. |
| Name | 2-[(2-amino-6-oxo-3H-purin-9-yl)methoxy]ethyl (2S)-2-(ethylamino)-3-methylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H24N6O4 |
|---|---|
| Molecular Weight | 352.38900 |
| Exact Mass | 352.18600 |
| PSA | 138.14000 |
| LogP | 0.58650 |
| InChIKey | OKUHBUGXDSIJIM-JTQLQIEISA-N |
| SMILES | CCNC(C(=O)OCCOCn1cnc2c(=O)[nH]c(N)nc21)C(C)C |
| RIDADR | NONH for all modes of transport |
|---|
| Valacyclovir related compound D [USP] |
| Valacyclovir related compound D |
| Acyclovir N-ethyl-L-valinate |
| Valaciclovir hydrochloride,anhydrous specified impurity D [EP] |
| 2-((2-Amino-6-oxo-1,6-dihydro-9H-purin-9-yl)methoxy)ethyl N-ethyl-L-valinate |
| N-Ethyl valacyclovir |
| (2-Amino-1,6-dihydro-6-oxo-9H-purin-9-yl)methoxy]ethyl N-ethyl-L-valinate |
| 2-[(2-Amino-6-oxo-1,6-dihydro-9H-purin-9-yl)methoxy]ethyl N-ethyl-L-valinate |
| Valacyclovir Related Compound D |
| Valacyclovir related compound D RS [USP] |
| L-Valine,N-ethyl-,2-((2-amino-1,6-dihydro-6-oxo-9H-purin-9-yl)methoxy)ethyl ester |