7-(4-Hydroxy-2-oxo-2H-[1]benzopyran-3-yl)-6,7-dihydro-8H-bis-[1]benzopyrano[4,3-b:3',4'-e]pyran-6,8-dion structure
|
Common Name | 7-(4-Hydroxy-2-oxo-2H-[1]benzopyran-3-yl)-6,7-dihydro-8H-bis-[1]benzopyrano[4,3-b:3',4'-e]pyran-6,8-dion | ||
|---|---|---|---|---|
| CAS Number | 13475-19-9 | Molecular Weight | 478.40600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H14O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-(4-Hydroxy-2-oxo-2H-[1]benzopyran-3-yl)-6,7-dihydro-8H-bis-[1]benzopyrano[4,3-b:3',4'-e]pyran-6,8-dion |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C28H14O8 |
|---|---|
| Molecular Weight | 478.40600 |
| Exact Mass | 478.06900 |
| PSA | 120.09000 |
| LogP | 4.99730 |
| InChIKey | PMUHMVLTTXRCBH-UHFFFAOYSA-N |
| SMILES | O=c1oc2ccccc2c(O)c1C1c2c(c3ccccc3oc2=O)Oc2c1c(=O)oc1ccccc21 |
|
Name: Integration of DNA by HIV -1 integrase
Source: ChEMBL
Target: Integrase
External Id: CHEMBL701718
|
|
Name: Inhibitory activity against 3'-processing of DNA by HIV-1 integrase
Source: ChEMBL
Target: Integrase
External Id: CHEMBL701116
|
|
Name: Inhibition of Human immunodeficiency virus 1 integrase
Source: ChEMBL
Target: Integrase
External Id: CHEMBL3055360
|
| .7-(4-Hydroxy-(3)cumarinyl)-6H,7H,8H-bis-(1)benzopyrano[4.3-b:3'.4'-e]pyran-6,8-dion |
| 7-[4-Hydroxy-[3]cumarinyl]-6H,7H,8H-bis-[1]benzopyrano[4,3-b:3',4'-e]pyran-6,8-dion |
| .7-[4-Hydroxy-(3)cumarinyl]-6H,7H,8H-bis-(1)benzopyrano[4.3-b:3'.4'-e]pyran-6,8-dion |