Rasburicase
Modify Date: 2024-04-12 10:59:18
Rasburicase structure
|
Common Name | Rasburicase | ||
|---|---|---|---|---|
| CAS Number | 134774-45-1 | Molecular Weight | N/A | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C1523H2383N417O462S7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RasburicaseRasburicase is a recombinant urate oxidase and a hyperuricemia inhibitor. Rasburicase converts uric acid into allantoin, making it easier to be cleared by the kidneys and improving the elevated level of uric acid in the blood[1]. |
| Name | Rasburicase |
|---|---|
| Synonym | More Synonyms |
| Description | Rasburicase is a recombinant urate oxidase and a hyperuricemia inhibitor. Rasburicase converts uric acid into allantoin, making it easier to be cleared by the kidneys and improving the elevated level of uric acid in the blood[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C1523H2383N417O462S7 |
|---|---|
| InChIKey | WNKDYIHLNSAHRF-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(=S)Nc1ccc(Cl)cc1Cl |
| RASBURICASE |