4-amino-2-methyl-6-nitrophenol structure
|
Common Name | 4-amino-2-methyl-6-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 13478-91-6 | Molecular Weight | 168.15000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-amino-2-methyl-6-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H8N2O3 |
|---|---|
| Molecular Weight | 168.15000 |
| Exact Mass | 168.05300 |
| PSA | 92.07000 |
| LogP | 2.29540 |
| InChIKey | UDLIJCWLNMTQCF-UHFFFAOYSA-N |
| SMILES | Cc1cc(N)cc([N+](=O)[O-])c1O |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Amino-2-methyl-6-nitro-phenol |
| 6-Nitro-4-amino-o-kresol |
| 3-Nitro-5-amino-2-oxy-1-methyl-benzol |