7-azidobicyclo[4.4.1]undeca-1,3,5,7,9-pentaene structure
|
Common Name | 7-azidobicyclo[4.4.1]undeca-1,3,5,7,9-pentaene | ||
|---|---|---|---|---|
| CAS Number | 134858-12-1 | Molecular Weight | 183.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-azidobicyclo[4.4.1]undeca-1,3,5,7,9-pentaene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9N3 |
|---|---|
| Molecular Weight | 183.20900 |
| Exact Mass | 183.08000 |
| PSA | 49.75000 |
| LogP | 3.10976 |
| InChIKey | JCDHWZWJHVCBNL-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NC1=CC=CC2=CC=CC=C1C2 |
|
~37%
7-azidobicyclo[... CAS#:134858-12-1 |
| Literature: Kanomata, Nobuhiro; Kawaji, Hiroyuki; Nitta, Makoto Journal of Organic Chemistry, 1992 , vol. 57, # 2 p. 618 - 625 |
|
~%
7-azidobicyclo[... CAS#:134858-12-1 |
| Literature: Suschitzky, Hans; Kramer, Walter; Neidlein, Richard; Rosyk, Peter; Bohn, Thomas Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1991 , # 4 p. 923 - 927 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-azido-1,6-methanocyclodeca-1,3,5,7,9-diene |
| 2-azido-1,6-methano<10>annulene |
| Bicyclo[4.4.1]undeca-1,3,5,7,9-pentaene,2-azido |