5,7-dichloro-N-(2,6-dichloro-3-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide structure
|
Common Name | 5,7-dichloro-N-(2,6-dichloro-3-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 134892-32-3 | Molecular Weight | 427.09300 | |
| Density | 1.88g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H7Cl4N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,7-dichloro-N-(2,6-dichloro-3-methylphenyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.88g/cm3 |
|---|---|
| Molecular Formula | C12H7Cl4N5O2S |
| Molecular Weight | 427.09300 |
| Exact Mass | 424.90700 |
| PSA | 97.63000 |
| LogP | 5.00090 |
| Index of Refraction | 1.772 |
| InChIKey | FWQYDFJTQRNKMD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cl)c(NS(=O)(=O)c2nc3nc(Cl)cc(Cl)n3n2)c1Cl |
| HS Code | 2935009090 |
|---|
|
~73%
5,7-dichloro-N-... CAS#:134892-32-3 |
| Literature: DowElanco Patent: US5006656 A1, 1991 ; |
|
~%
5,7-dichloro-N-... CAS#:134892-32-3 |
| Literature: The Dow Chemical Company Patent: US4818273 A1, 1989 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N-(2,6-dichloro-3-methylphenyl)-5,7-dichloro-1,2,4-triazolo[1,5-a]pyrimidine-2-sulfonamide |
| I06-2652 |
| [1,2,4]Triazolo[1,5-a]pyrimidine-2-sulfonamide,5,7-dichloro-N-(2,6-dichloro-3-methylphenyl) |
| 5,7-Dichloro-N-(2,6-dichloro-3-methylphenyl)-1,2,4-triazolo[1,5-a]pyrimidine-2-sulfonamide |