Desmethyl-laquinimod
Modify Date: 2026-07-07 09:47:07
Desmethyl-laquinimod structure
|
Common Name | Desmethyl-laquinimod | ||
|---|---|---|---|---|
| CAS Number | 1349096-12-3 | Molecular Weight | 342.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Desmethyl-laquinimod |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H15ClN2O3 |
|---|---|
| Molecular Weight | 342.8 |
| InChIKey | PRSDPSUTNKQSOJ-UHFFFAOYSA-N |
| SMILES | CCN(C(=O)c1c(O)c2c(Cl)cccc2[nH]c1=O)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Desmethyl-laquinimod? |
| A: Molecular formula of Desmethyl-laquinimod is C18H15ClN2O3. |
| Q: What is the English name of Desmethyl-laquinimod? |
| A: The English name of Desmethyl-laquinimod is Desmethyl-laquinimod. |
| Q: What is the InChIKey of Desmethyl-laquinimod? |
| A: InChIKey of Desmethyl-laquinimod is PRSDPSUTNKQSOJ-UHFFFAOYSA-N. |
| Q: What is the CAS number of Desmethyl-laquinimod? |
| A: CAS number of Desmethyl-laquinimod is 1349096-12-3. |
| Q: What is the molecular weight of Desmethyl-laquinimod? |
| A: Molecular weight of Desmethyl-laquinimod is 342.8. |
| Q: What is the Chinese name of 1349096-12-3? |
| A: Chinese name of 1349096-12-3 is 1349096-12-3. |
| Q: What is the SMILES notation of Desmethyl-laquinimod? |
| A: SMILES notation of Desmethyl-laquinimod is CCN(C(=O)c1c(O)c2c(Cl)cccc2[nH]c1=O)c1ccccc1. |