Disodium 3-aminonaphthalene-2,7-disulphonate
Disodium 3-aminonaphthalene-2,7-disulphonate structure
|
Common Name | Disodium 3-aminonaphthalene-2,7-disulphonate | ||
|---|---|---|---|---|
| CAS Number | 135-50-2 | Molecular Weight | 347.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7NNa2O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Disodium 3-aminonaphthalene-2,7-disulphonate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7NNa2O6S2 |
|---|---|
| Molecular Weight | 347.27500 |
| Exact Mass | 346.95100 |
| PSA | 157.18000 |
| LogP | 2.97300 |
| InChIKey | YCBINYVMSDDQKZ-UHFFFAOYSA-L |
| SMILES | Nc1cc2ccc(S(=O)(=O)[O-])cc2cc1S(=O)(=O)[O-].[Na+].[Na+] |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Naphthylamine-3,6-Disulfonic Acid Sodium Salt |
| 3-amino-2,7-naphthalenedisulfonic acid disodium salt |
| disodium 3-azanylnaphthalene-2,7-disulfonate |
| Monosodium-2-Naphthylamine-3,6-Disulfonate |
| Amino R Salt |
| 3-Aminonaphthalene-2,7-disulfonic acid disodium salt |
| 2-Amino-3,6-naphthalenedisulfonic acid,disodium salt |
| disodium 3-aminonaphthalene-2,7-disulfonate |
| EINECS 205-195-8 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Disodium 3-aminonaphthalene-2,7-disulphonate? |
| A: Molecular formula of Disodium 3-aminonaphthalene-2,7-disulphonate is C10H7NNa2O6S2. |
| Q: What is the InChIKey of Disodium 3-aminonaphthalene-2,7-disulphonate? |
| A: InChIKey of Disodium 3-aminonaphthalene-2,7-disulphonate is YCBINYVMSDDQKZ-UHFFFAOYSA-L. |
| Q: What is the molecular weight of Disodium 3-aminonaphthalene-2,7-disulphonate? |
| A: Molecular weight of Disodium 3-aminonaphthalene-2,7-disulphonate is 347.27500. |
| Q: What English synonyms does Disodium 3-aminonaphthalene-2,7-disulphonate have? |
| A: English synonyms of Disodium 3-aminonaphthalene-2,7-disulphonate: 2-Naphthylamine-3,6-Disulfonic Acid Sodium Salt, 3-amino-2,7-naphthalenedisulfonic acid disodium salt, disodium 3-azanylnaphthalene-2,7-disulfonate, Monosodium-2-Naphthylamine-3,6-Disulfonate, Amino R Salt, 3-Aminonaphthalene-2,7-disulfonic acid disodium salt, 2-Amino-3,6-naphthalenedisulfonic acid,disodium salt, disodium 3-aminonaphthalene-2,7-disulfonate, EINECS 205-195-8. |
| Q: What is the English name of Disodium 3-aminonaphthalene-2,7-disulphonate? |
| A: The English name of Disodium 3-aminonaphthalene-2,7-disulphonate is Disodium 3-aminonaphthalene-2,7-disulphonate. |
| Q: What is the LogP of Disodium 3-aminonaphthalene-2,7-disulphonate? |
| A: LogP of Disodium 3-aminonaphthalene-2,7-disulphonate is 2.97300. |
| Q: What is the SMILES notation of Disodium 3-aminonaphthalene-2,7-disulphonate? |
| A: SMILES notation of Disodium 3-aminonaphthalene-2,7-disulphonate is Nc1cc2ccc(S(=O)(=O)[O-])cc2cc1S(=O)(=O)[O-].[Na+].[Na+]. |
| Q: What is the CAS number of Disodium 3-aminonaphthalene-2,7-disulphonate? |
| A: CAS number of Disodium 3-aminonaphthalene-2,7-disulphonate is 135-50-2. |
| Q: What is the polar surface area (PSA) of Disodium 3-aminonaphthalene-2,7-disulphonate? |
| A: Polar surface area (PSA) of Disodium 3-aminonaphthalene-2,7-disulphonate is 157.18000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |