3-hydroxy-2-naphthoic acid, compound with N,N-dibutyl-4-(hexyloxy)-1-naphthamidine (1:1) structure
|
Common Name | 3-hydroxy-2-naphthoic acid, compound with N,N-dibutyl-4-(hexyloxy)-1-naphthamidine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 13501-04-7 | Molecular Weight | 570.76100 | |
| Density | N/A | Boiling Point | 495ºC at 760 mmHg | |
| Molecular Formula | C36H46N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.1ºC | |
| Name | N,N-dibutyl-4-hexoxynaphthalene-1-carboximidamide,3-hydroxynaphthalene-2-carboxylic acid |
|---|
| Boiling Point | 495ºC at 760 mmHg |
|---|---|
| Molecular Formula | C36H46N2O4 |
| Molecular Weight | 570.76100 |
| Flash Point | 253.1ºC |
| Exact Mass | 570.34600 |
| PSA | 93.85000 |
| LogP | 9.36980 |
| Vapour Pressure | 6.16E-10mmHg at 25°C |
| InChIKey | JDLVRYVSMFCHMT-UHFFFAOYSA-N |
| SMILES | CCCCCCOc1ccc(C(=N)N(CCCC)CCCC)c2ccccc12.O=C(O)c1cc2ccccc2cc1O |