2-ethyl-4-hydroxyquinoline-6-carbonitrile structure
|
Common Name | 2-ethyl-4-hydroxyquinoline-6-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 135016-07-8 | Molecular Weight | 198.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-ethyl-4-oxo-1H-quinoline-6-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10N2O |
|---|---|
| Molecular Weight | 198.22100 |
| Exact Mass | 198.07900 |
| PSA | 56.65000 |
| LogP | 1.96218 |
| InChIKey | RXFGCBPFMAWMOO-UHFFFAOYSA-N |
| SMILES | CCc1cc(=O)c2cc(C#N)ccc2[nH]1 |
|
~%
2-ethyl-4-hydro... CAS#:135016-07-8 |
| Literature: Bradbury; Allott; Dennis; Fisher; Major; Masek; Oldham; Pearce; Rankine; Revill; Roberts; Russell Journal of Medicinal Chemistry, 1992 , vol. 35, # 22 p. 4027 - 4038 |
|
~%
2-ethyl-4-hydro... CAS#:135016-07-8 |
| Literature: Bradbury; Allott; Dennis; Fisher; Major; Masek; Oldham; Pearce; Rankine; Revill; Roberts; Russell Journal of Medicinal Chemistry, 1992 , vol. 35, # 22 p. 4027 - 4038 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-ETHYL-4-HYDROXYQUINOLINE-6-CARBONITRILE |
| 6-Cyano-2-ethyl-4-quinolone |