Ethyl 2-(diethoxyphosphoryl)-3-(1-naphthyl)acrylate structure
|
Common Name | Ethyl 2-(diethoxyphosphoryl)-3-(1-naphthyl)acrylate | ||
|---|---|---|---|---|
| CAS Number | 13507-51-2 | Molecular Weight | 362.35700 | |
| Density | 1.193g/cm3 | Boiling Point | 505.5ºC at 760 mmHg | |
| Molecular Formula | C19H23O5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.6ºC | |
| Name | ethyl (Z)-2-diethoxyphosphoryl-3-naphthalen-1-ylprop-2-enoate |
|---|
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 505.5ºC at 760 mmHg |
| Molecular Formula | C19H23O5P |
| Molecular Weight | 362.35700 |
| Flash Point | 272.6ºC |
| Exact Mass | 362.12800 |
| PSA | 71.64000 |
| LogP | 5.00990 |
| Vapour Pressure | 2.41E-10mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | UXIVPFUAIKXJLT-JXAWBTAJSA-N |
| SMILES | CCOC(=O)C(=Cc1cccc2ccccc12)P(=O)(OCC)OCC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |