Carbamicacid, dimethylthio-, S-[p-(dimethylamino)phenyl] ester (8CI) structure
|
Common Name | Carbamicacid, dimethylthio-, S-[p-(dimethylamino)phenyl] ester (8CI) | ||
|---|---|---|---|---|
| CAS Number | 13512-02-2 | Molecular Weight | 224.32300 | |
| Density | 1.14g/cm3 | Boiling Point | 343.5ºC at 760mmHg | |
| Molecular Formula | C11H16N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.5ºC | |
| Name | S-[4-(dimethylamino)phenyl] N,N-dimethylcarbamothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 343.5ºC at 760mmHg |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.32300 |
| Flash Point | 161.5ºC |
| Exact Mass | 224.09800 |
| PSA | 48.85000 |
| LogP | 2.52630 |
| Vapour Pressure | 7.01E-05mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | QXGFZGQZQMRXGV-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Sc1ccc(N(C)C)cc1 |
|
~%
Carbamicacid, d... CAS#:13512-02-2 |
| Literature: Newman,M.S.; Karnes,H.A. Journal of Organic Chemistry, 1966 , vol. 31, p. 3980 - 3984 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N,N-Dimethyl-thiocarbamidsaeure-S-(4-dimethylamino-phenylester) |
| S-(4-dimethylaminophenyl) N,N-dimethylcarbamothioate |