Cytidine, 2'-deoxy-2'-fluoro-4'-thio structure
|
Common Name | Cytidine, 2'-deoxy-2'-fluoro-4'-thio | ||
|---|---|---|---|---|
| CAS Number | 135123-37-4 | Molecular Weight | 261.279 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12FN3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Cytidine, 2'-deoxy-2'-fluoro-4'-thio |
|---|
| Molecular Formula | C9H12FN3O3S |
|---|---|
| Molecular Weight | 261.279 |
| InChIKey | NIDPJRZOVFIBQB-XVFCMESISA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2[C@@H]([C@@H]([C@H](S2)CO)O)F |
|
Name: Determination of IC50 values for inhibition of SARS-CoV-2 induced cytotoxicity of VER...
Source: ChEMBL
Target: Severe acute respiratory syndrome coronavirus 2
External Id: CHEMBL4651404
|