Nonadeca-1,18-dien-10-yl 4-bromobutanoate
Modify Date: 2025-10-11 11:56:58
Nonadeca-1,18-dien-10-yl 4-bromobutanoate structure
|
Common Name | Nonadeca-1,18-dien-10-yl 4-bromobutanoate | ||
|---|---|---|---|---|
| CAS Number | 1351586-52-1 | Molecular Weight | 429.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H41BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Nonadeca-1,18-dien-10-yl 4-bromobutanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H41BrO2 |
|---|---|
| Molecular Weight | 429.5 |
| InChIKey | RIOTUNWSQDKZAF-UHFFFAOYSA-N |
| SMILES | C=CCCCCCCCC(CCCCCCCC=C)OC(=O)CCCBr |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Nonadeca-1,18-dien-10-yl 4-bromobutanoate? |
| A: CAS number of Nonadeca-1,18-dien-10-yl 4-bromobutanoate is 1351586-52-1. |
| Q: What is the SMILES notation of Nonadeca-1,18-dien-10-yl 4-bromobutanoate? |
| A: SMILES notation of Nonadeca-1,18-dien-10-yl 4-bromobutanoate is C=CCCCCCCCC(CCCCCCCC=C)OC(=O)CCCBr. |
| Q: What is the English name of Nonadeca-1,18-dien-10-yl 4-bromobutanoate? |
| A: The English name of Nonadeca-1,18-dien-10-yl 4-bromobutanoate is Nonadeca-1,18-dien-10-yl 4-bromobutanoate. |
| Q: What is the molecular weight of Nonadeca-1,18-dien-10-yl 4-bromobutanoate? |
| A: Molecular weight of Nonadeca-1,18-dien-10-yl 4-bromobutanoate is 429.5. |
| Q: What is the molecular formula of Nonadeca-1,18-dien-10-yl 4-bromobutanoate? |
| A: Molecular formula of Nonadeca-1,18-dien-10-yl 4-bromobutanoate is C23H41BrO2. |
| Q: What is the InChIKey of Nonadeca-1,18-dien-10-yl 4-bromobutanoate? |
| A: InChIKey of Nonadeca-1,18-dien-10-yl 4-bromobutanoate is RIOTUNWSQDKZAF-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1351586-52-1? |
| A: Chinese name of 1351586-52-1 is 1351586-52-1. |