2-[4-[2-(4-oxaldehydoylphenyl)ethyl]phenyl]-2-oxo-acetaldehyde structure
|
Common Name | 2-[4-[2-(4-oxaldehydoylphenyl)ethyl]phenyl]-2-oxo-acetaldehyde | ||
|---|---|---|---|---|
| CAS Number | 13516-56-8 | Molecular Weight | 294.30100 | |
| Density | 1.222g/cm3 | Boiling Point | 435.2ºC at 760 mmHg | |
| Molecular Formula | C18H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.5ºC | |
| Name | 2-[4-[2-(4-oxaldehydoylphenyl)ethyl]phenyl]-2-oxoacetaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 435.2ºC at 760 mmHg |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.30100 |
| Flash Point | 187.5ºC |
| Exact Mass | 294.08900 |
| PSA | 68.28000 |
| LogP | 2.23500 |
| Vapour Pressure | 8.94E-08mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | HIQAEPZKKYAGFD-UHFFFAOYSA-N |
| SMILES | O=CC(=O)c1ccc(CCc2ccc(C(=O)C=O)cc2)cc1 |
|
~%
2-[4-[2-(4-oxal... CAS#:13516-56-8 |
| Literature: Cavallini,G. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 255 - 258 |
|
~%
2-[4-[2-(4-oxal... CAS#:13516-56-8 |
| Literature: Seikachi,H.; Muto,H. Chemical and Pharmaceutical Bulletin, 1971 , vol. 19, p. 2262 - 2270 |
|
~%
2-[4-[2-(4-oxal... CAS#:13516-56-8 |
| Literature: Seikachi,H.; Muto,H. Chemical and Pharmaceutical Bulletin, 1971 , vol. 19, p. 2262 - 2270 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4,4'-Bisglyoxalyldiphenylethan |