(E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide
Modify Date: 2025-10-01 06:21:38
(E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide structure
|
Common Name | (E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide | ||
|---|---|---|---|---|
| CAS Number | 1351663-62-1 | Molecular Weight | 261.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15NO2S |
|---|---|
| Molecular Weight | 261.34 |
| InChIKey | YPORXSVVCSNIQJ-ONEGZZNKSA-N |
| SMILES | Cc1cc(CNC(=O)C=Cc2ccsc2)c(C)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1351663-62-1? |
| A: Chinese name of 1351663-62-1 is 1351663-62-1. |
| Q: What is the molecular weight of (E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide? |
| A: Molecular weight of (E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide is 261.34. |
| Q: What is the English name of (E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide? |
| A: The English name of (E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide is (E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide. |
| Q: What is the CAS number of (E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide? |
| A: CAS number of (E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide is 1351663-62-1. |
| Q: What is the molecular formula of (E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide? |
| A: Molecular formula of (E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide is C14H15NO2S. |
| Q: What is the SMILES notation of (E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide? |
| A: SMILES notation of (E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide is Cc1cc(CNC(=O)C=Cc2ccsc2)c(C)o1. |
| Q: What is the InChIKey of (E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide? |
| A: InChIKey of (E)-N-((2,5-dimethylfuran-3-yl)methyl)-3-(thiophen-3-yl)acrylamide is YPORXSVVCSNIQJ-ONEGZZNKSA-N. |