(E)-3-(3-(benzo[d][1,3]dioxol-5-yl)acrylamido)cyclohexyl (4-fluorophenyl)carbamate structure
|
Common Name | (E)-3-(3-(benzo[d][1,3]dioxol-5-yl)acrylamido)cyclohexyl (4-fluorophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 1351663-64-3 | Molecular Weight | 426.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H23FN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E)-3-(3-(benzo[d][1,3]dioxol-5-yl)acrylamido)cyclohexyl (4-fluorophenyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H23FN2O5 |
|---|---|
| Molecular Weight | 426.4 |
| InChIKey | AFPRDQUTLKEKKU-VZUCSPMQSA-N |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)NC1CCCC(OC(=O)Nc2ccc(F)cc2)C1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (E)-3-(3-(benzo[d][1,3]dioxol-5-yl)acrylamido)cyclohexyl (4-fluorophenyl)carbamate? |
| A: CAS number of (E)-3-(3-(benzo[d][1,3]dioxol-5-yl)acrylamido)cyclohexyl (4-fluorophenyl)carbamate is 1351663-64-3. |
| Q: What is the molecular weight of (E)-3-(3-(benzo[d][1,3]dioxol-5-yl)acrylamido)cyclohexyl (4-fluorophenyl)carbamate? |
| A: Molecular weight of (E)-3-(3-(benzo[d][1,3]dioxol-5-yl)acrylamido)cyclohexyl (4-fluorophenyl)carbamate is 426.4. |
| Q: What is the SMILES notation of (E)-3-(3-(benzo[d][1,3]dioxol-5-yl)acrylamido)cyclohexyl (4-fluorophenyl)carbamate? |
| A: SMILES notation of (E)-3-(3-(benzo[d][1,3]dioxol-5-yl)acrylamido)cyclohexyl (4-fluorophenyl)carbamate is O=C(C=Cc1ccc2c(c1)OCO2)NC1CCCC(OC(=O)Nc2ccc(F)cc2)C1. |
| Q: What is the molecular formula of (E)-3-(3-(benzo[d][1,3]dioxol-5-yl)acrylamido)cyclohexyl (4-fluorophenyl)carbamate? |
| A: Molecular formula of (E)-3-(3-(benzo[d][1,3]dioxol-5-yl)acrylamido)cyclohexyl (4-fluorophenyl)carbamate is C23H23FN2O5. |
| Q: What is the English name of (E)-3-(3-(benzo[d][1,3]dioxol-5-yl)acrylamido)cyclohexyl (4-fluorophenyl)carbamate? |
| A: The English name of (E)-3-(3-(benzo[d][1,3]dioxol-5-yl)acrylamido)cyclohexyl (4-fluorophenyl)carbamate is (E)-3-(3-(benzo[d][1,3]dioxol-5-yl)acrylamido)cyclohexyl (4-fluorophenyl)carbamate. |
| Q: What is the InChIKey of (E)-3-(3-(benzo[d][1,3]dioxol-5-yl)acrylamido)cyclohexyl (4-fluorophenyl)carbamate? |
| A: InChIKey of (E)-3-(3-(benzo[d][1,3]dioxol-5-yl)acrylamido)cyclohexyl (4-fluorophenyl)carbamate is AFPRDQUTLKEKKU-VZUCSPMQSA-N. |
| Q: What is the Chinese name of 1351663-64-3? |
| A: Chinese name of 1351663-64-3 is 1351663-64-3. |