N1-methyl-1-phenylethane-1,2-diamine dimaleate
Modify Date: 2025-09-24 17:43:02
N1-methyl-1-phenylethane-1,2-diamine dimaleate structure
|
Common Name | N1-methyl-1-phenylethane-1,2-diamine dimaleate | ||
|---|---|---|---|---|
| CAS Number | 1351663-69-8 | Molecular Weight | 382.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N1-methyl-1-phenylethane-1,2-diamine dimaleate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H22N2O8 |
|---|---|
| Molecular Weight | 382.4 |
| InChIKey | YCSLRDPQRHNOKB-SPIKMXEPSA-N |
| SMILES | CNC(CN)c1ccccc1.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N1-methyl-1-phenylethane-1,2-diamine dimaleate? |
| A: SMILES notation of N1-methyl-1-phenylethane-1,2-diamine dimaleate is CNC(CN)c1ccccc1.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O. |
| Q: What is the CAS number of N1-methyl-1-phenylethane-1,2-diamine dimaleate? |
| A: CAS number of N1-methyl-1-phenylethane-1,2-diamine dimaleate is 1351663-69-8. |
| Q: What is the molecular formula of N1-methyl-1-phenylethane-1,2-diamine dimaleate? |
| A: Molecular formula of N1-methyl-1-phenylethane-1,2-diamine dimaleate is C17H22N2O8. |
| Q: What is the InChIKey of N1-methyl-1-phenylethane-1,2-diamine dimaleate? |
| A: InChIKey of N1-methyl-1-phenylethane-1,2-diamine dimaleate is YCSLRDPQRHNOKB-SPIKMXEPSA-N. |
| Q: What is the Chinese name of 1351663-69-8? |
| A: Chinese name of 1351663-69-8 is 1351663-69-8. |
| Q: What is the molecular weight of N1-methyl-1-phenylethane-1,2-diamine dimaleate? |
| A: Molecular weight of N1-methyl-1-phenylethane-1,2-diamine dimaleate is 382.4. |
| Q: What is the English name of N1-methyl-1-phenylethane-1,2-diamine dimaleate? |
| A: The English name of N1-methyl-1-phenylethane-1,2-diamine dimaleate is N1-methyl-1-phenylethane-1,2-diamine dimaleate. |