1-methyl-1H-benzo[d]imidazol-5-yl cinnamate
Modify Date: 2026-08-15 20:33:43
![1-methyl-1H-benzo[d]imidazol-5-yl cinnamate Structure](https://www.chemsrc.com/extcaspic/193/1351663-93-8.png)
1-methyl-1H-benzo[d]imidazol-5-yl cinnamate structure
|
Common Name | 1-methyl-1H-benzo[d]imidazol-5-yl cinnamate | ||
|---|---|---|---|---|
| CAS Number | 1351663-93-8 | Molecular Weight | 278.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methyl-1H-benzo[d]imidazol-5-yl cinnamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H14N2O2 |
|---|---|
| Molecular Weight | 278.30 |
| InChIKey | GGPCJNGBUGDCFE-JXMROGBWSA-N |
| SMILES | Cn1cnc2cc(OC(=O)C=Cc3ccccc3)ccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-methyl-1H-benzo[d]imidazol-5-yl cinnamate? |
| A: The English name of 1-methyl-1H-benzo[d]imidazol-5-yl cinnamate is 1-methyl-1H-benzo[d]imidazol-5-yl cinnamate. |
| Q: What is the SMILES notation of 1-methyl-1H-benzo[d]imidazol-5-yl cinnamate? |
| A: SMILES notation of 1-methyl-1H-benzo[d]imidazol-5-yl cinnamate is Cn1cnc2cc(OC(=O)C=Cc3ccccc3)ccc21. |
| Q: What is the molecular formula of 1-methyl-1H-benzo[d]imidazol-5-yl cinnamate? |
| A: Molecular formula of 1-methyl-1H-benzo[d]imidazol-5-yl cinnamate is C17H14N2O2. |
| Q: What is the molecular weight of 1-methyl-1H-benzo[d]imidazol-5-yl cinnamate? |
| A: Molecular weight of 1-methyl-1H-benzo[d]imidazol-5-yl cinnamate is 278.30. |
| Q: What is the InChIKey of 1-methyl-1H-benzo[d]imidazol-5-yl cinnamate? |
| A: InChIKey of 1-methyl-1H-benzo[d]imidazol-5-yl cinnamate is GGPCJNGBUGDCFE-JXMROGBWSA-N. |
| Q: What is the Chinese name of 1351663-93-8? |
| A: Chinese name of 1351663-93-8 is 1351663-93-8. |
| Q: What is the CAS number of 1-methyl-1H-benzo[d]imidazol-5-yl cinnamate? |
| A: CAS number of 1-methyl-1H-benzo[d]imidazol-5-yl cinnamate is 1351663-93-8. |