2-Bromobenzene-1,3,5-tricarboxylicacid structure
|
Common Name | 2-Bromobenzene-1,3,5-tricarboxylicacid | ||
|---|---|---|---|---|
| CAS Number | 13520-03-1 | Molecular Weight | 289.03600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5BrO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Bromo-1,3,5-benzenetricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H5BrO6 |
|---|---|
| Molecular Weight | 289.03600 |
| Exact Mass | 287.92700 |
| PSA | 111.90000 |
| LogP | 1.54370 |
| InChIKey | FLDATZLQLJIBDG-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(C(=O)O)c(Br)c(C(=O)O)c1 |
| HS Code | 2917399090 |
|---|
|
~61%
2-Bromobenzene-... CAS#:13520-03-1 |
| Literature: Holy, Petr; Zavada, Jiri; Zezula, Josef; Cisarva, Ivana; Podlaha, Jaroslav Collection of Czechoslovak Chemical Communications, 2001 , vol. 66, # 5 p. 820 - 832 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Silane,bromotrifluoro |
| bromotrifluorosilane |
| Brom-trimesinsaeure |
| 2-Bromobenzene-1,3,5-tricarboxylic acid |
| Bromtrifluorsilan |