3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl
Modify Date: 2025-09-09 16:57:01
3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl structure
|
Common Name | 3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl | ||
|---|---|---|---|---|
| CAS Number | 1352050-06-6 | Molecular Weight | 843.0 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C62H42N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C62H42N4 |
|---|---|
| Molecular Weight | 843.0 |
| InChIKey | CVGWEMWDBHDGPR-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2c(-c3ccccc3)c(-c3ccc(-c4ccncc4)cc3)c(-c3ccc(-c4ccncc4)cc3)c(-c3ccc(-c4ccncc4)cc3)c2-c2ccc(-c3ccncc3)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl? |
| A: CAS number of 3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl is 1352050-06-6. |
| Q: What is the English name of 3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl? |
| A: The English name of 3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl is 3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl. |
| Q: What is the InChIKey of 3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl? |
| A: InChIKey of 3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl is CVGWEMWDBHDGPR-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1352050-06-6? |
| A: Chinese name of 1352050-06-6 is 1352050-06-6. |
| Q: What is the SMILES notation of 3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl? |
| A: SMILES notation of 3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl is c1ccc(-c2c(-c3ccccc3)c(-c3ccc(-c4ccncc4)cc3)c(-c3ccc(-c4ccncc4)cc3)c(-c3ccc(-c4ccncc4)cc3)c2-c2ccc(-c3ccncc3)cc2)cc1. |
| Q: What is the molecular formula of 3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl? |
| A: Molecular formula of 3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl is C62H42N4. |
| Q: What is the molecular weight of 3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl? |
| A: Molecular weight of 3',4',5',6'-Tetrakis(4-(pyridin-4-yl)phenyl)-1,1':2',1''-terphenyl is 843.0. |