2-(4-methylphenyl)-1,1-dioxo-6-phenylthiopyran-4-one structure
|
Common Name | 2-(4-methylphenyl)-1,1-dioxo-6-phenylthiopyran-4-one | ||
|---|---|---|---|---|
| CAS Number | 135215-37-1 | Molecular Weight | 310.36700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-methylphenyl)-1,1-dioxo-6-phenylthiopyran-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H14O3S |
|---|---|
| Molecular Weight | 310.36700 |
| Exact Mass | 310.06600 |
| PSA | 59.59000 |
| LogP | 4.45530 |
| InChIKey | JPIDDKLLGVAPEJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C2=CC(=O)C=C(c3ccccc3)S2(=O)=O)cc1 |
|
~57%
2-(4-methylphen... CAS#:135215-37-1 |
| Literature: Marei, Mohamed Gaber Phosphorus, Sulfur and Silicon and the Related Elements, 1993 , vol. 81, # 1-4 p. 101 - 110 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4H-Thiopyran-4-one,2-(4-methylphenyl)-6-phenyl-,1,1-dioxide |