N,N-dimethyl-1-[(13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl)oxy]methanethioamide structure
|
Common Name | N,N-dimethyl-1-[(13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl)oxy]methanethioamide | ||
|---|---|---|---|---|
| CAS Number | 13522-76-4 | Molecular Weight | 357.51000 | |
| Density | 1.179g/cm3 | Boiling Point | 477.2ºC at 760 mmHg | |
| Molecular Formula | C21H27NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.4ºC | |
| Name | O-[(13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl)] N,N-dimethylcarbamothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 477.2ºC at 760 mmHg |
| Molecular Formula | C21H27NO2S |
| Molecular Weight | 357.51000 |
| Flash Point | 242.4ºC |
| Exact Mass | 357.17600 |
| PSA | 61.63000 |
| LogP | 4.33710 |
| Vapour Pressure | 2.86E-09mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | LYJMSUZAFPBCJV-UHFFFAOYSA-N |
| SMILES | CN(C)C(=S)Oc1ccc2c(c1)CCC1C2CCC2(C)C(=O)CCC12 |
|
~89%
N,N-dimethyl-1-... CAS#:13522-76-4 |
| Literature: Li, Pui-Kai; Pillai, Radhakrishnan; Young, Barry L.; Bender, William H.; Martino, Dino M.; Lin, Fu-Tyan Steroids, 1993 , vol. 58, # 3 p. 106 - 111 |
|
~%
N,N-dimethyl-1-... CAS#:13522-76-4 |
| Literature: Newman,M.S.; Karnes,H.A. Journal of Organic Chemistry, 1966 , vol. 31, p. 3980 - 3984 |
| 3-<(N,N-dimethylthiocarbamoyl)oxy>estra-1,3,5(10)-trien-17-one |
| N,N-DIMETHYL-1-[(13-METHYL-17-OXO-7,8,9,11,12,14,15,16-OCTAHYDRO-6H-CYCLOPENTA[A]PHENANTHREN-3-YL)OXY]METHANETHIOAMIDE |
| 3-<N,N-Dimethyl-thiocarbamoyloxy>-estran-17-on |
| O-[17-oxoestra-1,3,5(10)-trien-3-yl] dimethylcarbamothioate |