1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl
Modify Date: 2025-09-09 18:13:52
![1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl Structure](https://www.chemsrc.com/extcaspic/493/1352398-57-2.png)
1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl structure
|
Common Name | 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl | ||
|---|---|---|---|---|
| CAS Number | 1352398-57-2 | Molecular Weight | 182.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H7ClN2O |
|---|---|
| Molecular Weight | 182.61 |
| InChIKey | IKLSPQQGWONNEC-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(Cl)c(O)cnc2[nH]1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl? |
| A: InChIKey of 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl is IKLSPQQGWONNEC-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl? |
| A: CAS number of 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl is 1352398-57-2. |
| Q: What is the molecular formula of 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl? |
| A: Molecular formula of 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl is C8H7ClN2O. |
| Q: What is the molecular weight of 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl? |
| A: Molecular weight of 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl is 182.61. |
| Q: What is the SMILES notation of 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl? |
| A: SMILES notation of 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl is Cc1cc2c(Cl)c(O)cnc2[nH]1. |
| Q: What is the English name of 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl? |
| A: The English name of 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl is 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-chloro-2-methyl. |
| Q: What is the Chinese name of 1352398-57-2? |
| A: Chinese name of 1352398-57-2 is 1352398-57-2. |