Balsaminoside B
Modify Date: 2026-04-16 05:22:22
Balsaminoside B structure
|
Common Name | Balsaminoside B | ||
|---|---|---|---|---|
| CAS Number | 1352809-95-0 | Molecular Weight | 620.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H60O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Balsaminoside B |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C36H60O8 |
|---|---|
| Molecular Weight | 620.9 |
| InChIKey | POYBZOIHJHDZFP-MNOOCEDISA-N |
| SMILES | C[C@H](C[C@H](C=C(C)C)O)[C@H]1CC[C@@]2([C@@]1(CC[C@@]3([C@H]2[C@H](C=C4[C@H]3CC[C@@H](C4(C)C)O)O[C@H]5[C@@H]([C@@H]([C@@H]([C@H](O5)CO)O)O)O)C)C)C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 23, Current Page 1 of 3
1
2
3
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Balsaminoside B? |
| A: InChIKey of Balsaminoside B is POYBZOIHJHDZFP-MNOOCEDISA-N. |
| Q: What is the SMILES notation of Balsaminoside B? |
| A: SMILES notation of Balsaminoside B is C[C@H](C[C@H](C=C(C)C)O)[C@H]1CC[C@@]2([C@@]1(CC[C@@]3([C@H]2[C@H](C=C4[C@H]3CC[C@@H](C4(C)C)O)O[C@H]5[C@@H]([C@@H]([C@@H]([C@H](O5)CO)O)O)O)C)C)C. |
| Q: What is the molecular weight of Balsaminoside B? |
| A: Molecular weight of Balsaminoside B is 620.9. |
| Q: What is the Chinese name of 1352809-95-0? |
| A: Chinese name of 1352809-95-0 is 1352809-95-0. |
| Q: What is the molecular formula of Balsaminoside B? |
| A: Molecular formula of Balsaminoside B is C36H60O8. |
| Q: What is the CAS number of Balsaminoside B? |
| A: CAS number of Balsaminoside B is 1352809-95-0. |
| Q: What is the English name of Balsaminoside B? |
| A: The English name of Balsaminoside B is Balsaminoside B. |