Pyrrolo[1,2-a]pyrazine-7-carboxylic acid, octahydro-2-(phenylmethyl) structure
|
Common Name | Pyrrolo[1,2-a]pyrazine-7-carboxylic acid, octahydro-2-(phenylmethyl) | ||
|---|---|---|---|---|
| CAS Number | 1352925-65-5 | Molecular Weight | 260.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Pyrrolo[1,2-a]pyrazine-7-carboxylic acid, octahydro-2-(phenylmethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H20N2O2 |
|---|---|
| Molecular Weight | 260.33 |
| InChIKey | IWCZMAZEWZKSRD-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CC2CN(Cc3ccccc3)CCN2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Pyrrolo[1,2-a]pyrazine-7-carboxylic acid, octahydro-2-(phenylmethyl)? |
| A: CAS number of Pyrrolo[1,2-a]pyrazine-7-carboxylic acid, octahydro-2-(phenylmethyl) is 1352925-65-5. |
| Q: What is the SMILES notation of Pyrrolo[1,2-a]pyrazine-7-carboxylic acid, octahydro-2-(phenylmethyl)? |
| A: SMILES notation of Pyrrolo[1,2-a]pyrazine-7-carboxylic acid, octahydro-2-(phenylmethyl) is O=C(O)C1CC2CN(Cc3ccccc3)CCN2C1. |
| Q: What is the molecular weight of Pyrrolo[1,2-a]pyrazine-7-carboxylic acid, octahydro-2-(phenylmethyl)? |
| A: Molecular weight of Pyrrolo[1,2-a]pyrazine-7-carboxylic acid, octahydro-2-(phenylmethyl) is 260.33. |
| Q: What is the English name of Pyrrolo[1,2-a]pyrazine-7-carboxylic acid, octahydro-2-(phenylmethyl)? |
| A: The English name of Pyrrolo[1,2-a]pyrazine-7-carboxylic acid, octahydro-2-(phenylmethyl) is Pyrrolo[1,2-a]pyrazine-7-carboxylic acid, octahydro-2-(phenylmethyl). |
| Q: What is the Chinese name of 1352925-65-5? |
| A: Chinese name of 1352925-65-5 is 1352925-65-5. |
| Q: What is the InChIKey of Pyrrolo[1,2-a]pyrazine-7-carboxylic acid, octahydro-2-(phenylmethyl)? |
| A: InChIKey of Pyrrolo[1,2-a]pyrazine-7-carboxylic acid, octahydro-2-(phenylmethyl) is IWCZMAZEWZKSRD-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Pyrrolo[1,2-a]pyrazine-7-carboxylic acid, octahydro-2-(phenylmethyl)? |
| A: Molecular formula of Pyrrolo[1,2-a]pyrazine-7-carboxylic acid, octahydro-2-(phenylmethyl) is C15H20N2O2. |