S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate
Modify Date: 2025-08-28 22:17:54
![S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate Structure](https://www.chemsrc.com/extcaspic/278/1353763-25-3.png)
S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate structure
|
Common Name | S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate | ||
|---|---|---|---|---|
| CAS Number | 1353763-25-3 | Molecular Weight | 348.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H21ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H21ClO2S |
|---|---|
| Molecular Weight | 348.9 |
| InChIKey | OEMJDWBRMIKVQV-UHFFFAOYSA-N |
| SMILES | O=C(SCC(=O)C12CC3CC(CC(C3)C1)C2)c1ccc(Cl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate? |
| A: SMILES notation of S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate is O=C(SCC(=O)C12CC3CC(CC(C3)C1)C2)c1ccc(Cl)cc1. |
| Q: What is the Chinese name of 1353763-25-3? |
| A: Chinese name of 1353763-25-3 is 1353763-25-3. |
| Q: What is the molecular weight of S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate? |
| A: Molecular weight of S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate is 348.9. |
| Q: What is the InChIKey of S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate? |
| A: InChIKey of S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate is OEMJDWBRMIKVQV-UHFFFAOYSA-N. |
| Q: What is the molecular formula of S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate? |
| A: Molecular formula of S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate is C19H21ClO2S. |
| Q: What is the English name of S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate? |
| A: The English name of S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate is S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate. |
| Q: What is the CAS number of S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate? |
| A: CAS number of S-[2-(1-adamantyl)-2-oxoethyl] 4-chlorobenzene-carbothioate is 1353763-25-3. |