12α-Methoxygrandiflorenic acid structure
|
Common Name | 12α-Methoxygrandiflorenic acid | ||
|---|---|---|---|---|
| CAS Number | 135383-94-7 | Molecular Weight | 330.461 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H30O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 12α-Methoxygrandiflorenic acid12α-Methoxygrandiflorenic acid (compound 6) is a compound isolated from the whole plant of Wedelia chinensis (Osbeck.) [1]. |
| Name | 12alpha-Methoxygrandiflorenic acid |
|---|
| Description | 12α-Methoxygrandiflorenic acid (compound 6) is a compound isolated from the whole plant of Wedelia chinensis (Osbeck.) [1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H30O3 |
|---|---|
| Molecular Weight | 330.461 |
| InChIKey | OGFJKOZDMWYQDJ-KLSAVCNVSA-N |
| SMILES | C=C1CC23CCC4C(C)(C(=O)O)CCCC4(C)C2=CC(OC)C1C3 |
| Storage condition | 2-8℃ |