4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide
![4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide Structure](https://image.chemsrc.com/caspic/092/13541-38-3.png)
4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide structure
|
Common Name | 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 13541-38-3 | Molecular Weight | 268.31000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H16N2O2 |
|---|---|
| Molecular Weight | 268.31000 |
| Exact Mass | 268.12100 |
| PSA | 65.18000 |
| LogP | 3.85370 |
| InChIKey | RAPWKNSUESJDOY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)NC(=O)c2ccc(C)cc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~92%
4-methyl-N-[(4-... CAS#:13541-38-3 |
| Literature: Singh, Atul K.; Chawla, Ruchi; Yadav, Lal Dhar S. Tetrahedron Letters, 2013 , vol. 54, # 37 p. 5099 - 5102 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-p-Tolyl,N'-p-toluyl-harnstoff |
| Benzamide,4-methyl-N-[[(4-methylphenyl)amino]carbonyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide? |
| A: SMILES notation of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide is Cc1ccc(NC(=O)NC(=O)c2ccc(C)cc2)cc1. |
| Q: What are the upstream materials of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide? |
| A: Related upstream materials(CAS) of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide: 619-55-6. |
| Q: What is the Chinese name of 13541-38-3? |
| A: Chinese name of 13541-38-3 is 13541-38-3. |
| Q: What is the CAS number of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide? |
| A: CAS number of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide is 13541-38-3. |
| Q: What English synonyms does 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide have? |
| A: English synonyms of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide: N-p-Tolyl,N'-p-toluyl-harnstoff, Benzamide,4-methyl-N-[[(4-methylphenyl)amino]carbonyl]. |
| Q: What is the LogP of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide? |
| A: LogP of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide is 3.85370. |
| Q: What is the molecular weight of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide? |
| A: Molecular weight of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide is 268.31000. |
| Q: What is the polar surface area (PSA) of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide? |
| A: Polar surface area (PSA) of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide is 65.18000. |
| Q: What is the InChIKey of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide? |
| A: InChIKey of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide is RAPWKNSUESJDOY-UHFFFAOYSA-N. |
| Q: What is the English name of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide? |
| A: The English name of 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide is 4-methyl-N-[(4-methylphenyl)carbamoyl]benzamide. |