sodium salt of 4-hydroxy coumarin structure
|
Common Name | sodium salt of 4-hydroxy coumarin | ||
|---|---|---|---|---|
| CAS Number | 13546-81-1 | Molecular Weight | 184.12400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5NaO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sodium salt of 4-hydroxy coumarin |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H5NaO3 |
|---|---|
| Molecular Weight | 184.12400 |
| Exact Mass | 184.01400 |
| PSA | 53.27000 |
| LogP | 1.93680 |
| InChIKey | PVPUJFSDEPNVOC-UHFFFAOYSA-N |
| SMILES | O=c1[cH-]c(=O)c2ccccc2o1.[Na+] |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 4-hydroxycoumarin sodium salt |
| .4-Hydroxycoumarin |